Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Raphin1 acetate is an orally bioavailable, selective inhibitor of the regulatory phosphatase PPP1R15B (R15B). |
|---|
| Catalog Num | A21373 |
|---|---|
| Formula | C10H12Cl2N4O2 |
| Molecular Weight | 291.13 |
| CAS Number | 2242616-04-0 |
| SMILES | N=C(N/N=C/C1=CC=CC(Cl)=C1Cl)N.CC(O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (195.79 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (27.47 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.35 mL | 171.74 mL | 343.49 mL |
| 0.5 mM | 6.87 mL | 34.35 mL | 68.7 mL |
| 1 mM | 3.43 mL | 17.17 mL | 34.35 mL |
| 5 mM | 0.69 mL | 3.43 mL | 6.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
