Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rifaximin is a semisynthetic, rifamycin-based non-systemic antibiotic, meaning that very little of the drug will pass the gastrointestinal wall into the circulation as is common for other types of orally administered antibiotics. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10793 |
|---|---|
| Formula | C43H51N3O11 |
| Molecular Weight | 785.88 |
| CAS Number | 80621-81-4 |
| SMILES | C[C@H]1/C=C/C=C(\C(=O)NC2=C(C3=C(C4=C(C(=C3O)C)O[C@@](C4=O)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C5=C2N6C=CC(=CC6=N5)C)O)/C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (57.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (3.81 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.72 mL | 63.62 mL | 127.25 mL |
| 0.5 mM | 2.54 mL | 12.72 mL | 25.45 mL |
| 1 mM | 1.27 mL | 6.36 mL | 12.72 mL |
| 5 mM | 0.25 mL | 1.27 mL | 2.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
