Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rimantadine is an orally administered antiviral drug used to treat, and in rare cases prevent, influenzavirus A infection. |
|---|
| Catalog Num | A17649 |
|---|---|
| Formula | C12H22ClN |
| Molecular Weight | 215.77 |
| CAS Number | 1501-84-4 |
| SMILES | CC(N)C12CC3CC(C2)CC(C3)C1.[H]Cl |
| Synonyms | Rimantadine, Flumadine, Remantadine, Riamantadine, Rimantadine Hydrochloride, Rimantadine HCl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (185.39 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.35 mL | 231.73 mL | 463.46 mL |
| 0.5 mM | 9.27 mL | 46.35 mL | 92.69 mL |
| 1 mM | 4.63 mL | 23.17 mL | 46.35 mL |
| 5 mM | 0.93 mL | 4.63 mL | 9.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
