Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | STF-083010 is a specific IRE1α inhibitor. STF-083010 inhibits Ire1 endonuclease activity, without affecting its kinase activity, after endoplasmic reticulum stress. |
|---|
| Catalog Num | A16720 |
|---|---|
| Formula | C15H11NO3S2 |
| Molecular Weight | 317.38 |
| CAS Number | 307543-71-1 |
| SMILES | O=S(C1=CC=CS1)(/N=C/C2=C3C=CC=CC3=CC=C2O)=O |
| Synonyms | STF083010, STF 083010 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 54 mg/mL (170.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+40%PEG 300+5% Tween80 +ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.51 mL | 157.54 mL | 315.08 mL |
| 0.5 mM | 6.3 mL | 31.51 mL | 63.02 mL |
| 1 mM | 3.15 mL | 15.75 mL | 31.51 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
