Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SCH 23390 hydrochloride is a potent dopamine receptor antagonist (Ki values are 0.2 nM and 0.3 nM at D1 and D5 receptor sub-types, respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13066 |
|---|---|
| Formula | C17H18ClNO.HCl |
| Molecular Weight | 324.24 |
| CAS Number | 125941-87-9 |
| SMILES | CN1CCC2=CC(=C(C=C2C(C1)C3=CC=CC=C3)O)Cl.Cl |
| Synonyms | (R)-(+)-SCH 23390 hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (191.21 mM) | |
| Water | 19 mg/mL (58.6 mM) | ||
| Ethanol | 24 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.84 mL | 154.21 mL | 308.41 mL |
| 0.5 mM | 6.17 mL | 30.84 mL | 61.68 mL |
| 1 mM | 3.08 mL | 15.42 mL | 30.84 mL |
| 5 mM | 0.62 mL | 3.08 mL | 6.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
