Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Selpercatinib is a tyrosine kinase inhibitor with antineoplastic properties. |
|---|
| Catalog Num | A18637 |
|---|---|
| Formula | C29H31N7O3 |
| Molecular Weight | 525.24 |
| CAS Number | 2152628-33-4 |
| SMILES | N#CC1=C2C(C3=CC=C(N4CC(C5)N(CC6=CC=C(OC)N=C6)C5C4)N=C3)=CC(OCC(C)(O)C)=CN2N=C1 |
| Synonyms | Selpercatinib, LOXO292, LOXO 292 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 21 mg/mL (39.95 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.04 mL | 95.19 mL | 190.39 mL |
| 0.5 mM | 3.81 mL | 19.04 mL | 38.08 mL |
| 1 mM | 1.9 mL | 9.52 mL | 19.04 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
