Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SRI-011381 hydrochloride is a TGF-beta signaling agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16210 |
|---|---|
| Formula | C20H32ClN3O |
| Molecular Weight | 365.94 |
| CAS Number | 1629138-41-5 (free base) |
| SMILES | C1CCC(CC1)NC(=O)N(CC2CCNCC2)CC3=CC=CC=C3.Cl |
| Synonyms | SRI011381 hydrochloride, SRI 011381 hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (179.07 mM) | |
| Water | Insoluble | ||
| Ethanol | 59 mg/mL (179.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.33 mL | 136.63 mL | 273.27 mL |
| 0.5 mM | 5.47 mL | 27.33 mL | 54.65 mL |
| 1 mM | 2.73 mL | 13.66 mL | 27.33 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
