Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | T-3775440 (hydrochloride) is an irreversible lysine-specific histone demethylase (LSD1) inhibitor with an IC50 value of 2.1 nM. |
|---|
| Catalog Num | A18340 |
|---|---|
| Formula | C18H23ClN4O |
| Molecular Weight | 346.85 |
| CAS Number | 1422535-52-1 |
| SMILES | O=C(C1=CN(C)N=C1)NC2=CC=C([C@H]3[C@H](NCC4CC4)C3)C=C2.[H]Cl |
| Synonyms | T-3775440 HCl; T 3775440 HCl; T3775440 HCl; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (190.28 mM) | |
| Water | 21 mg/mL (60.54 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.83 mL | 144.15 mL | 288.31 mL |
| 0.5 mM | 5.77 mL | 28.83 mL | 57.66 mL |
| 1 mM | 2.88 mL | 14.42 mL | 28.83 mL |
| 5 mM | 0.58 mL | 2.88 mL | 5.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
