Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TCS PIM-1 1 is a potent and selective ATP-competitive Pim-1 kianse inhibitor with IC50 of 50 nM, displays good selectivity over Pim-2 and MEK1/MEK2(IC50s >20,000 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15369 |
|---|---|
| Formula | C18H11BrN2O2 |
| Molecular Weight | 367.2 |
| CAS Number | 491871-58-0 |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=C2)C3=C(C=CC(=C3)Br)O)C#N |
| Synonyms | SC 204330, TCS PIM 1-1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (190.63 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.23 mL | 136.17 mL | 272.33 mL |
| 0.5 mM | 5.45 mL | 27.23 mL | 54.47 mL |
| 1 mM | 2.72 mL | 13.62 mL | 27.23 mL |
| 5 mM | 0.54 mL | 2.72 mL | 5.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
