Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | UBCS039 is the first synthetic, specific Sirtuin 6 (SIRT6) activator, inducing autophagy in human tumor cells, with an EC50 of 38 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18961 |
|---|---|
| Formula | C16H13N3 |
| Molecular Weight | 247.29 |
| CAS Number | 358721-70-7 |
| SMILES | N12C(C(C3=CC=CN=C3)NC4=C2C=CC=C4)=CC=C1 |
| Synonyms | UBCS 039, UBCS-039 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (169.83 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (56.61 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.44 mL | 202.19 mL | 404.38 mL |
| 0.5 mM | 8.09 mL | 40.44 mL | 80.88 mL |
| 1 mM | 4.04 mL | 20.22 mL | 40.44 mL |
| 5 mM | 0.81 mL | 4.04 mL | 8.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
