Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Retinol, also known as Vitamin A, and derivatives of it that play an essential role in metabolic functioning of the retina, the growth of and differentiation of epithelial tissue, the growth of bone, reproduction, and the immune response. Dietary vitamin A is derived from a variety of carotenoids found in plants. |
|---|
| Catalog Num | A17696 |
|---|---|
| Formula | C20H30O |
| Molecular Weight | 286.45 |
| CAS Number | 68-26-8 |
| SMILES | OC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| Synonyms | Retinol; Afaxin; Aoral; Avibon; Biosterol; Prepalin; Testavol; Vafol; Vitamin A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (195.49 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.91 mL | 174.55 mL | 349.1 mL |
| 0.5 mM | 6.98 mL | 34.91 mL | 69.82 mL |
| 1 mM | 3.49 mL | 17.46 mL | 34.91 mL |
| 5 mM | 0.7 mL | 3.49 mL | 6.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
