Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WNK-IN-11 is an allosteric With-No-Lysine (WNK) kinase inhibitor, with an IC50 of 4 nM for WNK1. |
|---|
| Catalog Num | A13153 |
|---|---|
| Formula | C21H21Cl2N5OS |
| Molecular Weight | 462.4 |
| CAS Number | 2123489-30-3 |
| SMILES | O=C(C1=CC(C2=CSC(NC)=N2)=NC=C1Cl)N3CCN(CC4=CC=C(Cl)C=C4)CC3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (185.98 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (19.46 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.63 mL | 108.13 mL | 216.26 mL |
| 0.5 mM | 4.33 mL | 21.63 mL | 43.25 mL |
| 1 mM | 2.16 mL | 10.81 mL | 21.63 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
