Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | X-376 is a potent and highly specific ALK tyrosine kinase inhibitor (TKI) (IC50=0.61 nM). X-376 is a less potent inhibitor of MET (IC50=0.69 nM). X-376 displays potent anti-tumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20971 |
|---|---|
| Formula | C25H25Cl2FN6O3 |
| Molecular Weight | 547.41 |
| CAS Number | 1365267-27-1 |
| SMILES | O=C(C1=NN=C(N)C(O[C@@H](C2=C(Cl)C=CC(F)=C2Cl)C)=C1)NC3=CC=C(C(N4CCN(C)CC4)=O)C=C3 |
| Synonyms | X376, X 376 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (171.71 mM) | |
| Water | Insoluble | ||
| Ethanol | 12 mg/mL (21.91 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.27 mL | 91.34 mL | 182.68 mL |
| 0.5 mM | 3.65 mL | 18.27 mL | 36.54 mL |
| 1 mM | 1.83 mL | 9.13 mL | 18.27 mL |
| 5 mM | 0.37 mL | 1.83 mL | 3.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
