Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Elvitegravir (GS-9137) is a potent inhibitor of the strand-transfer step of integration mediated by human immunodeficiency virus type 1 (HIV-1) integrase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10347 |
|---|---|
| Formula | C23H23ClFNO5 |
| Molecular Weight | 447.9 |
| CAS Number | 697761-98-1 |
| SMILES | CC(C)[C@@H](CO)N1C=C(C(=O)C2=CC(=C(C=C21)OC)CC3=C(C(=CC=C3)Cl)F)C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (189.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 33 mg/mL (73.67 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.33 mL | 111.63 mL | 223.26 mL |
| 0.5 mM | 4.47 mL | 22.33 mL | 44.65 mL |
| 1 mM | 2.23 mL | 11.16 mL | 22.33 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
