Etoposide (VP-16)
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
Discription | Etoposide forms a ternary complex with DNA and the topoisomerase II enzyme (which aids in DNA unwinding), prevents re-ligation of the DNA strands, and by doing so causes DNA strands to break. Therefore, this causes errors in DNA synthesis and promotes apoptosis of the cancer cell. | ||
---|---|---|---|
Targets |
|
Catalog Num | A10373 |
---|---|
Formula | C29H32O13 |
Molecular Weight | 588.6 |
CAS Number | 33419-42-0 |
SMILES | C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O |
Synonyms | Vepesid |
Storage | Store lyophilized at -20ºC, keep desiccated. |
In vitro (25°C) | DMSO | 99 mg/mL (168.2 mM) | |
Water | Insoluble | ||
Ethanol | Insoluble | ||
In vivo | 5% DMSO+40% PEG 300+5% Tween 80+ddH2O | 14 mg/mL | |
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
---|---|---|---|
0.1 mM | 16.99 mL | 84.95 mL | 169.89 mL |
0.5 mM | 3.4 mL | 16.99 mL | 33.98 mL |
1 mM | 1.7 mL | 8.49 mL | 16.99 mL |
5 mM | 0.34 mL | 1.7 mL | 3.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2