Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Geraniin is a dehydroellagitannin found in geraniums. |
|---|
| Catalog Num | A14716 |
|---|---|
| Formula | C41H28O27 |
| Molecular Weight | 952.64 |
| CAS Number | 60976-49-0 |
| SMILES | OC1=C(O)C(O)=C(C(C(O)=C(O)C(O)=C2)=C2C(O[C@H]3[C@@H]4OC(C(C=C(O)C(O)=C5OC6(O)C(O)7O)=C5C7C8=CC6=O)=O)=O)C(C(OC[C@H](O[C@@H]4OC(C9=CC(O)=C(O)C(O)=C9)=O)[C@@H]3OC8=O)=O)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (100.77 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.5 mL | 52.49 mL | 104.97 mL |
| 0.5 mM | 2.1 mL | 10.5 mL | 20.99 mL |
| 1 mM | 1.05 mL | 5.25 mL | 10.5 mL |
| 5 mM | 0.21 mL | 1.05 mL | 2.1 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
