Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK-525762A is a small molecule inhibitor of the BET (Bromodomain and Extra-Terminal) family | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11440 |
|---|---|
| Formula | C22H22ClN5O2 |
| Molecular Weight | 423.9 |
| CAS Number | 1260907-17-2 |
| SMILES | CCNC(=O)C[C@H]1C2=NN=C(N2C3=C(C=C(C=C3)OC)C(=N1)C4=CC=C(C=C4)Cl)C |
| Synonyms | GSK-525762A, GSK525762A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (169.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 36 mg/mL (84.92 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.59 mL | 117.95 mL | 235.9 mL |
| 0.5 mM | 4.72 mL | 23.59 mL | 47.18 mL |
| 1 mM | 2.36 mL | 11.8 mL | 23.59 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
