Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Indirubin, the active constituent of a Chinese antileukaemia medicine, is a potent cyclin-dependent kinases and GSK-3β inhibitor with IC50 of about 5 μM and 0.6 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10471 |
|---|---|
| Formula | C16H10N2O2 |
| Molecular Weight | 262.3 |
| CAS Number | 479-41-4 |
| SMILES | C1=CC=C2C(=C1)/C(=C\3/C(=O)C4=CC=CC=C4N3)/C(=O)N2 |
| Synonyms | Couroupitine B, Indigo red |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (183.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.12 mL | 190.62 mL | 381.24 mL |
| 0.5 mM | 7.62 mL | 38.12 mL | 76.25 mL |
| 1 mM | 3.81 mL | 19.06 mL | 38.12 mL |
| 5 mM | 0.76 mL | 3.81 mL | 7.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
