Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | INH6 is a potent Hec1 inhibitor, which specifically disrupts the Hec1/Nek2 interaction and causes chromosome mis-alignment. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14200 |
|---|---|
| Formula | C19H18N2OS |
| Molecular Weight | 322.42 |
| CAS Number | 1001753-24-7 |
| SMILES | CC1=CC(=C(C(=C1)C)C2=CSC(=N2)NC(=O)C3=CC=CC=C3)C |
| Synonyms | INH 6,INH-6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 58 mg/mL (179.88 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 10 mg/mL (31.01 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.02 mL | 155.08 mL | 310.15 mL |
| 0.5 mM | 6.2 mL | 31.02 mL | 62.03 mL |
| 1 mM | 3.1 mL | 15.51 mL | 31.02 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
