Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Janex-1 is a cell-permeable, reversible, potent, ATP-competitive, and specific inhibitor of JAK3 (IC50 = 78 uM); has no effect on JAK1, JAK2, or Zap/Syk or SRC tyrosine kinases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15134 |
|---|---|
| Formula | C16H15N3O3 |
| Molecular Weight | 297.31 |
| CAS Number | 202475-60-3 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)O)OC |
| Synonyms | WHI-P131, Janex 1, WHI-P 131 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (16.81 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.63 mL | 168.17 mL | 336.35 mL |
| 0.5 mM | 6.73 mL | 33.63 mL | 67.27 mL |
| 1 mM | 3.36 mL | 16.82 mL | 33.63 mL |
| 5 mM | 0.67 mL | 3.36 mL | 6.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
