Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JK184 is potent downstream hedgehog (Hh) signaling inhibitor that prevents Gli-dependent transcriptional activity (IC50 = 30 nM). |
|---|
| Catalog Num | A12925 |
|---|---|
| Formula | C19H18N4OS |
| Molecular Weight | 350.44 |
| CAS Number | 315703-52-7 |
| SMILES | CCOC1=CC=C(C=C1)NC2=NC(=CS2)C3=C(N=C4N3C=CC=C4)C |
| Synonyms | JK184 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (196.89 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (39.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.54 mL | 142.68 mL | 285.36 mL |
| 0.5 mM | 5.71 mL | 28.54 mL | 57.07 mL |
| 1 mM | 2.85 mL | 14.27 mL | 28.54 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
