Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | KN-62 is a selective, cell-permeable inhibitor of CaM kinase II. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11473 |
|---|---|
| Formula | C38H35N5O6S2 |
| Molecular Weight | 721.8 |
| CAS Number | 127191-97-3 |
| SMILES | CN([C@@H](CC1=CC=C(C=C1)OS(=O)(=O)C2=CC=CC3=C2C=CN=C3)C(=O)N4CCN(CC4)C5=CC=CC=C5)S(=O)(=O)C6=CC=CC7=C6C=CN=C7 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (132.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.85 mL | 69.27 mL | 138.54 mL |
| 0.5 mM | 2.77 mL | 13.85 mL | 27.71 mL |
| 1 mM | 1.39 mL | 6.93 mL | 13.85 mL |
| 5 mM | 0.28 mL | 1.39 mL | 2.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
