Signaling Pathway
KW-2478 is an agent that targets the human heat-shock protein 90 (Hsp90) with potential antineoplastic activity.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KW-2478 is an agent that targets the human heat-shock protein 90 (Hsp90) with potential antineoplastic activity. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11195 |
|---|---|
| Formula | C30H42N2O9 |
| Molecular Weight | 574.66 |
| CAS Number | 819812-04-9 |
| SMILES | CCC1=C(C=C(C(=C1CC(=O)N(CCOC)CCOC)C(=O)C2=CC(=C(C=C2)OCCN3CCOCC3)OC)O)O |
| Synonyms | KW2478 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 114 mg/mL (198.37 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (5.22 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.4 mL | 87.01 mL | 174.02 mL |
| 0.5 mM | 3.48 mL | 17.4 mL | 34.8 mL |
| 1 mM | 1.74 mL | 8.7 mL | 17.4 mL |
| 5 mM | 0.35 mL | 1.74 mL | 3.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
