Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lamivudine is a potent nucleoside analog reverse transcriptase inhibitor (nRTI). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10512 |
|---|---|
| Formula | C8H11N3O3S |
| Molecular Weight | 229.25 |
| CAS Number | 134678-17-4 |
| SMILES | C1[C@H](O[C@H](S1)CO)N2C=CC(=NC2=O)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (170.11 mM) | |
| Water | 39 mg/mL (170.11 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.62 mL | 218.1 mL | 436.21 mL |
| 0.5 mM | 8.72 mL | 43.62 mL | 87.24 mL |
| 1 mM | 4.36 mL | 21.81 mL | 43.62 mL |
| 5 mM | 0.87 mL | 4.36 mL | 8.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
