Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lapatinib is a dual tyrosine kinase inhibitor which interrupts the HER2 growth receptor pathway. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10514 |
|---|---|
| Formula | C43H42ClFN4O10S3 |
| Molecular Weight | 925.46 |
| CAS Number | 388082-77-7 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 93 mg/mL (100.49 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 10.81 mL | 54.03 mL | 108.05 mL |
| 0.5 mM | 2.16 mL | 10.81 mL | 21.61 mL |
| 1 mM | 1.08 mL | 5.4 mL | 10.81 mL |
| 5 mM | 0.22 mL | 1.08 mL | 2.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
