Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2886721 is a novel potent agent that is used to treat Alzheimer's Disease in preclinical experiments. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10543 |
|---|---|
| Formula | C18H16F2N4O2S |
| Molecular Weight | 390.4 |
| CAS Number | 1262036-50-9 |
| SMILES | C1[C@H]2CSC(=N[C@]2(CO1)C3=C(C=CC(=C3)NC(=O)C4=NC=C(C=C4)F)F)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (23.05 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.61 mL | 128.07 mL | 256.15 mL |
| 0.5 mM | 5.12 mL | 25.61 mL | 51.23 mL |
| 1 mM | 2.56 mL | 12.81 mL | 25.61 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
