Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Malotilate is a liver protein metabolism improved compound. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10552 |
|---|---|
| Formula | C12H16O4S2 |
| Molecular Weight | 288.4 |
| CAS Number | 59937-28-9 |
| SMILES | CC(C)OC(=O)C(=C1SC=CS1)C(=O)OC(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (176.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 51 mg/mL (176.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.67 mL | 173.37 mL | 346.74 mL |
| 0.5 mM | 6.93 mL | 34.67 mL | 69.35 mL |
| 1 mM | 3.47 mL | 17.34 mL | 34.67 mL |
| 5 mM | 0.69 mL | 3.47 mL | 6.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
