Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MI-3 is a potent menin-MLL interaction inhibitor with IC50 of 648 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14218 |
|---|---|
| Formula | C18H25N5S2 |
| Molecular Weight | 375.55 |
| CAS Number | 1271738-59-0 |
| SMILES | CC(C)C1=CC2=C(N=CN=C2S1)N3CCN(CC3)C4=NCC(S4)(C)C |
| Synonyms | Menin-MLL Inhibitor |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 17 mg/mL (45.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 17 mg/mL (45.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.63 mL | 133.14 mL | 266.28 mL |
| 0.5 mM | 5.33 mL | 26.63 mL | 53.26 mL |
| 1 mM | 2.66 mL | 13.31 mL | 26.63 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
