Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MK-2461, a novel multitargeted kinase inhibitor, preferentially inhibits the activated c-Met receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11753 |
|---|---|
| Formula | C24H25N5O5S |
| Molecular Weight | 495.6 |
| CAS Number | 917879-39-1 |
| SMILES | CN1C=C(C=N1)C2=CN=C3C=CC4=C(C=C(C=C4)NS(=O)(=O)N(C)C[C@@H]5COCCO5)C(=O)C3=C2 |
| Synonyms | MK2461 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 95 mg/mL (191.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80, pH 4 | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.18 mL | 100.89 mL | 201.78 mL |
| 0.5 mM | 4.04 mL | 20.18 mL | 40.36 mL |
| 1 mM | 2.02 mL | 10.09 mL | 20.18 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
