Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MK-5108, also known as VX-689, is a competitive inhibitor of the ATP-binding site of aurora A kinase. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11410 |
|---|---|
| Formula | C22H21ClFN3O3S |
| Molecular Weight | 461.9 |
| CAS Number | 1010085-13-8 |
| SMILES | C1CC(CCC1OC2=C(C(=CC=C2)Cl)F)(CC3=NC(=CC=C3)NC4=NC=CS4)C(=O)O |
| Synonyms | MK5108, VX689 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 81 mg/mL (175.35 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.65 mL | 108.25 mL | 216.5 mL |
| 0.5 mM | 4.33 mL | 21.65 mL | 43.3 mL |
| 1 mM | 2.16 mL | 10.82 mL | 21.65 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
