Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Moxalactam is a synthetically derived, structurally unique beta-lactam antibiotic. Its antimicrobial activity encompasses a wide spectrum and includes some strains of pseudomonal species. |
|---|
| Catalog Num | A11958 |
|---|---|
| Formula | C20H18N6Na2O9S |
| Molecular Weight | 564.44 |
| CAS Number | 64953-12-4 |
| SMILES | CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)C(C4=CC=C(C=C4)O)C(=O)[O-])OC)OC2)C(=O)[O-].[Na+].[Na+] |
| Synonyms | LY 127935 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (154.13 mM) | |
| Water | 87 mg/mL (154.13 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.72 mL | 88.58 mL | 177.17 mL |
| 0.5 mM | 3.54 mL | 17.72 mL | 35.43 mL |
| 1 mM | 1.77 mL | 8.86 mL | 17.72 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
