Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nitrisinone is a competitive inhibitor that reversibly inhibits 4-Hydroxyphenylpyruvate oxidase (dioxygenase). |
|---|
| Catalog Num | A11093 |
|---|---|
| Formula | C14H10F3NO5 |
| Molecular Weight | 329.2 |
| CAS Number | 104206-65-7 |
| SMILES | C1CC(=O)C(C(=O)C1)C(=O)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
| Synonyms | SC 0735, NTBC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (188.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.38 mL | 151.88 mL | 303.77 mL |
| 0.5 mM | 6.08 mL | 30.38 mL | 60.75 mL |
| 1 mM | 3.04 mL | 15.19 mL | 30.38 mL |
| 5 mM | 0.61 mL | 3.04 mL | 6.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
