Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ondansetron is a serotonin 5-HT3 receptor antagonist used mainly as an antiemetic to treat nausea and vomiting, often following chemotherapy. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10674 |
|---|---|
| Formula | C18H19N3O.HCl |
| Molecular Weight | 329.82 |
| CAS Number | 99614-01-4 |
| SMILES | CC1=NC=CN1CC2CCC3=C(C2=O)C4=CC=CC=C4N3C.Cl |
| Synonyms | Ondemet, Emeset, Emetron |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (178.88 mM) | |
| Water | 22 mg/mL (66.7 mM) | ||
| Ethanol | 9 mg/mL (27.28 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.32 mL | 151.6 mL | 303.2 mL |
| 0.5 mM | 6.06 mL | 30.32 mL | 60.64 mL |
| 1 mM | 3.03 mL | 15.16 mL | 30.32 mL |
| 5 mM | 0.61 mL | 3.03 mL | 6.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
