Total item
Cart Subtotal
$0.00 Biological Activity
OSI-906 is a potential first-in-class selective small molecule, dual kinase inhibitor of both insulin-like growth factor-1 receptor (IGF-1R) and insulin receptor (IR).
Targets
| Target | Value |
|---|---|
| IGF-1R | IC50: 35nM |
| Insulin Receptor | IC50: 75nM |
| IRR | IC50: 75nM |
| Abl | IC50: >10μM |
| ALK | IC50: >10μM |
| BTK | IC50: >10μM |
| EGFR | IC50: >10μM |
| EphA1 | IC50: >10μM |
| EphB1 | IC50: >10μM |
| FES | IC50: >10μM |
| FGFR1 | IC50: >10μM |
| FGFR2 | IC50: >10μM |
| Fyn | IC50: >10μM |
| PKA | IC50: >10μM |
| PKCα | IC50: >10μM |
| ROCK1 | IC50: >10μM |
| IRAK4 | IC50: >10μM |
| JAK2 | IC50: >10μM |
| KDR | IC50: >10μM |
| LCK | IC50: >10μM |
| LynA | IC50: >10μM |
| LynB | IC50: >10μM |
| Met | IC50: >10μM |
| TrkA | IC50: >10μM |
| PDGFRα | IC50: >10μM |
| PDGFRβ | IC50: >10μM |
| FAK | IC50: >10μM |
| BRK | IC50: >10μM |
| RET | IC50: >10μM |
| Pim1 | IC50: >10μM |
| CDK1 | IC50: >10μM |
| DYRK2 | IC50: >10μM |
| Src | IC50: >10μM |
| Tek | IC50: >10μM |
| MEK1 | IC50: >10μM |
| Akt1 | IC50: >10μM |
| Akt2 | IC50: >10μM |
| AuroraA | IC50: >10μM |
| AuroraB | IC50: >10μM |
| PDK-1 | IC50: >10μM |
| PLK1 | IC50: >10μM |
| p38α | IC50: >10μM |
| ERK1 | IC50: >10μM |
| GSK-3α | IC50: >10μM |
| p70S6K | IC50: >10μM |
| In vitro (25°C) | DMSO | 84 mg/mL (199.29 mM) | |
| Water | <1 mg/mL (<1 mM) | ||
| Ethanol | <1 mg/mL (<1 mM) | ||
| In vivo | 30% PEG400/0.5% Tween80/5% propylene glycol | 30 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.72 mL | 118.62 mL | 237.25 mL |
| 0.5 mM | 4.74 mL | 23.72 mL | 47.45 mL |
| 1 mM | 2.37 mL | 11.86 mL | 23.72 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
*The above data is based on the productmolecular weight 421.5 . Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Chemical Properties
| Catalog Num | A11053 |
|---|---|
| Actions | Inhibitor |
| M. Wt | 421.5 |
| Formula | C26H23N5O |
| Solubility | DMSO |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 867160-71-2 |
| Synonyms | OSI906, linsitinib |
| SMILES | CC1(CC(C1)C2=NC(=C3N2C=CN=C3N)C4=CC5=C(C=C4)C=CC(=N5)C6=CC=CC=C6)O |
Product Tags
Product Questions
Product Questions
No Questions
You may also be interested in the following product(s)
NVP-AEW541
NVP-AEW541 is a selective IGF-1R kinase inhibitor that inhibits the autophosphorylation activity of IGF-1R (IC50 = 0.086 uM) and prevents IG…
Picropodophyllin
Picropodophyllin (AXL1717) is the first targeted oral small-molecule IGF-1 receptor inhibitor with no effect on the insulin receptor.
NVP-ADW742
NVP-ADW742 is an IGF-1R inhibitor with IC50 of 0.17 μM.
GSK1904529A
GSK1904529A selectively inhibits IGF-IR and IR with IC(50)s of 27 and 25 nmol/L, respectively.
BMS-536924
BMS-536924 is an effective inhibitor of IGF-IR, causing a reversion of an IGF-IR - mediated transformed phenotype.
XL-228
XL228 is a protein kinase inhibitor targeting IGF1R, the AURORA kinases, FGFR1-3, ABL and SRC family kinases. XL228 is an Aurora A inhibitor…
PQ 401
PQ 401 is a cell-permeable phenylquinolinyl-urea compound that inhibits IGF-1R autophosphorylation.
AG-1024 (Tyrphostin)
AG-1024 (Tyrphostin) is a specific inhibitor of insulin-like growth factor-1 (IGF-1) and insulin receptor tyrosine kinase activity. Exhibits…
Keywords:buy OSI-906 | OSI-906 Supplier | purchase OSI-906 | OSI-906 cost | OSI-906 manufacturer | order OSI-906 | OSI-906 distributor | buy 867160-71-2| 867160-71-2 Supplier | purchase 867160-71-2 | 867160-71-2 cost | 867160-71-2 manufacturer | order 867160-71-2 | 867160-71-2 distributor
Adooq Quality Guarantee
We promise all products perform as described.