Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OSI-906 is a potential first-in-class selective small molecule, dual kinase inhibitor of both insulin-like growth factor-1 receptor (IGF-1R) and insulin receptor (IR). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11053 |
|---|---|
| Formula | C26H23N5O |
| Molecular Weight | 421.5 |
| CAS Number | 867160-71-2 |
| SMILES | CC1(CC(C1)C2=NC(=C3N2C=CN=C3N)C4=CC5=C(C=C4)C=CC(=N5)C6=CC=CC=C6)O |
| Synonyms | OSI906, linsitinib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 80 mg/mL (189.8 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%DMSO+40%PEG300+5%Tween80+50%ddH2O | 5.93 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.72 mL | 118.62 mL | 237.25 mL |
| 0.5 mM | 4.74 mL | 23.72 mL | 47.45 mL |
| 1 mM | 2.37 mL | 11.86 mL | 23.72 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
