Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | OTS964 is a potent TOPK inhibitor with an IC50 value of 28 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14331 |
|---|---|
| Formula | C23H25ClN2O2S |
| Molecular Weight | 429 |
| CAS Number | 1338545-07-5 |
| SMILES | CC1=CC(=C(C2=C1NC(=O)C3=C2C=CS3)C4=CC=C(C=C4)[C@@H](C)CN(C)C)O.Cl |
| Synonyms | OTS-964, OTS 964, OTS964 HCl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (177.16 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.33 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.31 mL | 116.55 mL | 233.1 mL |
| 0.5 mM | 4.66 mL | 23.31 mL | 46.62 mL |
| 1 mM | 2.33 mL | 11.66 mL | 23.31 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
