Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | P 22077 is a cell-permeable inhibitor of the ubiquitin-specific protease (IC?? = 8.6 μM) and the closely related deubiquitinase (DUB) USP47. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12933 |
|---|---|
| Formula | C12H7F2NO3S2 |
| Molecular Weight | 315.32 |
| CAS Number | 1247819-59-5 |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
| Synonyms | P22077 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 57 mg/mL (180.76 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.71 mL | 158.57 mL | 317.14 mL |
| 0.5 mM | 6.34 mL | 31.71 mL | 63.43 mL |
| 1 mM | 3.17 mL | 15.86 mL | 31.71 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
