Total item
Cart Subtotal
$0.00 Biological Activity
P 22077 is a cell-permeable inhibitor of the ubiquitin-specific protease (IC?? = 8.6 μM) and the closely related deubiquitinase (DUB) USP47.
Targets
| Target | Value | |
|---|---|---|
| USP7 | EC50 | 8.6μM |
| USP47 | EC50 | 8.74μM |
| USP2core | EC50 | >50μM |
| USP4 | EC50 | >50μM |
| USP5 | EC50 | >50μM |
| USP8 | EC50 | >50μM |
| USP15 | EC50 | >50μM |
| USP20 | EC50 | >50μM |
| USP28 | EC50 | >50μM |
| JOSD2 | EC50 | >50μM |
| UCH-L1 | EC50 | >50μM |
| UCH-L3 | EC50 | >50μM |
| UCH-L5 | EC50 | >50μM |
| DEN1 | EC50 | >50μM |
| Plpro | EC50 | >50μM |
| SENP6core | EC50 | >50μM |
| PLA2 | EC50 | >50μM |
| Calpain1 | EC50 | >50μM |
| CT-L | EC50 | >50μM |
| CathepsinD | EC50 | >50μM |
| MMP13 | EC50 | >50μM |
| Trypsin | EC50 | >50μM |
| In vitro (25°C) | DMSO | 57 mg/mL (180.76 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.71 mL | 158.57 mL | 317.14 mL |
| 0.5 mM | 6.34 mL | 31.71 mL | 63.43 mL |
| 1 mM | 3.17 mL | 15.86 mL | 31.71 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.34 mL |
*The above data is based on the productmolecular weight 315.32. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Catalog Num | A12933 |
|---|---|
| Actions | Inhibitor |
| CAS No. | 1247819-59-5 |
| Formula | C12H7F2NO3S2 |
| M. Wt | 315.32 |
| Purity | >98% |
| Synonyms | P22077 |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy P 22077 | P 22077 Supplier | purchase | cost | manufacturer | order | distributor | buy 1247819-59-5| 1247819-59-5 Supplier | purchase 1247819-59-5 | 1247819-59-5 cost | 1247819-59-5 manufacturer | order 1247819-59-5 | 1247819-59-5 distributor
Adooq Quality Guarantee
We promise all products perform as described.