Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Parecoxib is a potent and selective COX-2 inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13572 |
|---|---|
| Formula | C19H18N2O4S |
| Molecular Weight | 370.42 |
| CAS Number | 198470-84-7 |
| SMILES | CCC(=O)NS(=O)(=O)C1=CC=C(C=C1)C2=C(ON=C2C3=CC=CC=C3)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (197.07 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.39 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27 mL | 134.98 mL | 269.96 mL |
| 0.5 mM | 5.4 mL | 27 mL | 53.99 mL |
| 1 mM | 2.7 mL | 13.5 mL | 27 mL |
| 5 mM | 0.54 mL | 2.7 mL | 5.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
