Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PCI-34051 is a specific and potent histone deacetylase 8 (HDAC8) inhibitor, with >200-fold selectivity over the other HDAC isoforms. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11152 |
|---|---|
| Formula | C17H16N2O3 |
| Molecular Weight | 296.3 |
| CAS Number | 950762-95-5 |
| SMILES | COC1=CC=C(C=C1)CN2C=CC3=C2C=C(C=C3)C(=O)NO |
| Synonyms | PCI34051 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (195.73 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40%PEG300+5% tween80+50% H2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.75 mL | 168.75 mL | 337.5 mL |
| 0.5 mM | 6.75 mL | 33.75 mL | 67.5 mL |
| 1 mM | 3.37 mL | 16.87 mL | 33.75 mL |
| 5 mM | 0.67 mL | 3.37 mL | 6.75 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
