Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PD153035 is an extremely potent and specific inhibitor of the tyrosine kinase activity of EGFR. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10702 |
|---|---|
| Formula | C16H14BrN3O2.HCl |
| Molecular Weight | 396.7 |
| CAS Number | 183322-45-4 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Br)OC.Cl |
| Synonyms | ZM 252868, AG 1517, Tyrphostin AG 1517, SU 5271 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 0.46 mg/mL (1.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.21 mL | 126.04 mL | 252.08 mL |
| 0.5 mM | 5.04 mL | 25.21 mL | 50.42 mL |
| 1 mM | 2.52 mL | 12.6 mL | 25.21 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
