Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pectolinarigenin is a Cirsium isolate with anti-inflammatory activity and belongs to the flavones. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14706 |
|---|---|
| Formula | C17H14O6 |
| Molecular Weight | 314.3 |
| CAS Number | 520-12-7 |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)OC)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (295.9 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.82 mL | 159.08 mL | 318.17 mL |
| 0.5 mM | 6.36 mL | 31.82 mL | 63.63 mL |
| 1 mM | 3.18 mL | 15.91 mL | 31.82 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
