Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PHA665752 is a small-molecule inhibitor of c-Met/HGF/SF signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10713 |
|---|---|
| Formula | C32H34Cl2N4O4S |
| Molecular Weight | 641.6 |
| CAS Number | 477575-56-7 |
| SMILES | CC1=C(NC(=C1C(=O)N2CCC[C@@H]2CN3CCCC3)C)/C=C\4/C5=C(C=CC(=C5)S(=O)(=O)CC6=C(C=CC=C6Cl)Cl)NC4=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 124 mg/mL (193.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+castor oil | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.59 mL | 77.93 mL | 155.86 mL |
| 0.5 mM | 3.12 mL | 15.59 mL | 31.17 mL |
| 1 mM | 1.56 mL | 7.79 mL | 15.59 mL |
| 5 mM | 0.31 mL | 1.56 mL | 3.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
