Signaling Pathway
SCD1 inhibitor
Important Notice: For research use only. We do not sell to patients.
| Discription | stearoyl-CoA desaturase 1 (SCD1) inhibitor. Used to selectively eliminate undifferentiated human pluripotent stem cells (hPSCs) from culture; induces ER stress, attenuates protein synthesis and induces apoptosis in hPSCs. Prevents teratoma formation in immunocompromised mice. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12899 |
|---|---|
| Formula | C12H11N3O |
| Molecular Weight | 213.24 |
| CAS Number | 91396-88-2 |
| SMILES | C1=CC=C(C=C1)NNC(=O)C2=CC=NC=C2 |
| Synonyms | PluriSln-1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (173.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.9 mL | 234.48 mL | 468.96 mL |
| 0.5 mM | 9.38 mL | 46.9 mL | 93.79 mL |
| 1 mM | 4.69 mL | 23.45 mL | 46.9 mL |
| 5 mM | 0.94 mL | 4.69 mL | 9.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
