Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PR-619 is a cell-permeable, reversible, and broad-spectrum inhibitor of the deubiquitinylating enzymes (DUBs). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13190 |
|---|---|
| Formula | C7H5N5S2 |
| Molecular Weight | 223.28 |
| CAS Number | 2645-32-1 |
| SMILES | C1=C(C(=NC(=C1SC#N)N)N)SC#N |
| Synonyms | PR619, PR 619 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 42 mg/mL (188.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.79 mL | 223.93 mL | 447.87 mL |
| 0.5 mM | 8.96 mL | 44.79 mL | 89.57 mL |
| 1 mM | 4.48 mL | 22.39 mL | 44.79 mL |
| 5 mM | 0.9 mL | 4.48 mL | 8.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
