Signaling Pathway
Leukotriene receptor antagonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pranlukast is a selective cysteinyl leukotriene receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11908 |
|---|---|
| Formula | C27H23N5O4 |
| Molecular Weight | 481.5 |
| CAS Number | 103177-37-3 |
| SMILES | C1=CC=C(C=C1)CCCCOC2=CC=C(C=C2)C(=O)NC3=CC=CC4=C3OC(=CC4=O)C5=NNN=N5 |
| Synonyms | Ultair,ONO-1078 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 11 mg/mL (22.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.77 mL | 103.84 mL | 207.68 mL |
| 0.5 mM | 4.15 mL | 20.77 mL | 41.54 mL |
| 1 mM | 2.08 mL | 10.38 mL | 20.77 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
