Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Praziquantel is a highly effective anthelmintic against all Schistosoma species. |
|---|
| Catalog Num | A10750 |
|---|---|
| Formula | C19H24N2O2 |
| Molecular Weight | 312.41 |
| CAS Number | 55268-74-1 |
| SMILES | C1CCC(CC1)C(=O)N2CC3C4=CC=CC=C4CCN3C(=O)C2 |
| Synonyms | Droncit |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (176.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 55 mg/mL (176.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.01 mL | 160.05 mL | 320.09 mL |
| 0.5 mM | 6.4 mL | 32.01 mL | 64.02 mL |
| 1 mM | 3.2 mL | 16 mL | 32.01 mL |
| 5 mM | 0.64 mL | 3.2 mL | 6.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
