Signaling Pathway
Ribitol is a crystalline pentose alcohol formed by the reduction of ribose.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ribitol is a crystalline pentose alcohol formed by the reduction of ribose. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11185 |
|---|---|
| Formula | C5H12O5 |
| Molecular Weight | 152.15 |
| CAS Number | 488-81-3 |
| SMILES | C([C@H](C([C@H](CO)O)O)O)O |
| Synonyms | Adonit, Adonite, Adonitol, Adonitrol, Pentitol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 29 mg/mL (190.6 mM) | |
| Water | 29 mg/mL (190.6 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 65.72 mL | 328.62 mL | 657.25 mL |
| 0.5 mM | 13.14 mL | 65.72 mL | 131.45 mL |
| 1 mM | 6.57 mL | 32.86 mL | 65.72 mL |
| 5 mM | 1.31 mL | 6.57 mL | 13.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
