Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rilpivirine is a second-generation non-nucleoside reverse transcriptase inhibitor (NNRTI) with higher potency, longer half-life and reduced side-effect profile compared with older NNRTIs, such as efavirenz. |
|---|
| Catalog Num | A11542 |
|---|---|
| Formula | C22H18N6 |
| Molecular Weight | 366.4 |
| CAS Number | 500287-72-9 |
| SMILES | CC1=CC(=CC(=C1NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N)C)/C=C/C#N |
| Synonyms | R278474, TMC278, TMC-278 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (180.12 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.29 mL | 136.46 mL | 272.93 mL |
| 0.5 mM | 5.46 mL | 27.29 mL | 54.59 mL |
| 1 mM | 2.73 mL | 13.65 mL | 27.29 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
