Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Rosiglitazone works as an insulin sensitizer, by binding to the PPAR receptors in fat cells and making the cells more responsive to insulin. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A10807 |
|---|---|
| Formula | C18H19N3O3S |
| Molecular Weight | 357.4 |
| CAS Number | 122320-73-4 |
| SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3 |
| Synonyms | Avandia, BRL-49653 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 65 mg/mL (181.85 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.98 mL | 139.9 mL | 279.8 mL |
| 0.5 mM | 5.6 mL | 27.98 mL | 55.96 mL |
| 1 mM | 2.8 mL | 13.99 mL | 27.98 mL |
| 5 mM | 0.56 mL | 2.8 mL | 5.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
