Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rotigotine is dopamine D2 and D3 receptor agonist. Ki values are 13 and 0.71 nM for D2 and D3 respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11553 |
|---|---|
| Formula | C19H25NOS |
| Molecular Weight | 315.47 |
| CAS Number | 99755-59-6 |
| SMILES | CCCN(CCC1=CC=CS1)[C@H]2CCC3=C(C2)C=CC=C3O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (183.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 58 mg/mL (183.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.7 mL | 158.49 mL | 316.99 mL |
| 0.5 mM | 6.34 mL | 31.7 mL | 63.4 mL |
| 1 mM | 3.17 mL | 15.85 mL | 31.7 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
