Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Safinamide is a highly selective and reversible monoamine oxidase type B (MAO-B) inhibitor that increases neostriatal dopamine concentration. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13294 |
|---|---|
| Formula | C17H19FN2O2 |
| Molecular Weight | 302.34 |
| CAS Number | 133865-89-1 |
| SMILES | C[C@@H](C(=O)N)NCC1=CC=C(C=C1)OCC2=CC(=CC=C2)F |
| Synonyms | EMD 1195686, FCE 26743 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (171.99 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.08 mL | 165.38 mL | 330.75 mL |
| 0.5 mM | 6.62 mL | 33.08 mL | 66.15 mL |
| 1 mM | 3.31 mL | 16.54 mL | 33.08 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.62 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
